EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20ClNO2 |
| Net Charge | 0 |
| Average Mass | 269.772 |
| Monoisotopic Mass | 269.11826 |
| SMILES | CCOCN(C(=O)CCl)c1c(C)cccc1CC |
| InChI | InChI=1S/C14H20ClNO2/c1-4-12-8-6-7-11(3)14(12)16(10-18-5-2)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
| InChIKey | VTNQPKFIQCLBDU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetochlor (CHEBI:2394) has functional parent N-phenylacetamide (CHEBI:28884) |
| acetochlor (CHEBI:2394) has role environmental contaminant (CHEBI:78298) |
| acetochlor (CHEBI:2394) has role herbicide (CHEBI:24527) |
| acetochlor (CHEBI:2394) has role xenobiotic (CHEBI:35703) |
| acetochlor (CHEBI:2394) is a aromatic amide (CHEBI:62733) |
| acetochlor (CHEBI:2394) is a monocarboxylic acid amide (CHEBI:29347) |
| acetochlor (CHEBI:2394) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-chloro-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide |
| Synonyms | Source |
|---|---|
| 2-Chloro-2'-methyl-6-ethyl-N-ethoxymethylacetanilide | ChemIDplus |
| 2-Chloro-N-(ethoxymethyl)-6'-ethylacet-o-toluidide | ChemIDplus |
| 2-Chloro-N-(ethoxymethyl)-6'-ethyl-o-acetotoluidide | ChemIDplus |
| Acetochlor | KEGG COMPOUND |
| Acetochlore | ChemIDplus |
| UniProt Name | Source |
|---|---|
| acetochlor | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 12 | PPDB |
| acetochlor | Alan Wood's Pesticides |
| Acetochlor | Wikipedia |
| C10925 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2859702 | Reaxys |
| CAS:34256-82-1 | NIST Chemistry WebBook |
| CAS:34256-82-1 | ChemIDplus |
| CAS:34256-82-1 | KEGG COMPOUND |
| Citations |
|---|