EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(O)c(OC)c3o2)cc1O |
| InChI | InChI=1S/C18H16O8/c1-23-11-5-4-8(6-9(11)19)12-7-10(20)13-14(21)17(24-2)15(22)18(25-3)16(13)26-12/h4-7,19,21-22H,1-3H3 |
| InChIKey | BTMNGQCCCWTUQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acerosin (CHEBI:2382) has role metabolite (CHEBI:25212) |
| acerosin (CHEBI:2382) is a trihydroxyflavone (CHEBI:27116) |
| acerosin (CHEBI:2382) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,8-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,7,3'-trihydroxy-6,8,4'-trimethoxyflavone | ChEBI |
| Acerosin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003930 | KNApSAcK |
| C09982 | KEGG COMPOUND |
| HMDB0030812 | HMDB |
| LMPK12111473 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1406179 | Reaxys |
| CAS:15835-74-2 | KEGG COMPOUND |
| CAS:15835-74-2 | ChemIDplus |
| Citations |
|---|