EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H43NO18 |
| Net Charge | 0 |
| Average Mass | 645.608 |
| Monoisotopic Mass | 645.24801 |
| SMILES | C[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H43NO18/c1-6-11(26-8-2-7(3-27)12(30)15(33)13(8)31)14(32)19(37)24(40-6)43-22-10(5-29)42-25(20(38)17(22)35)44-21-9(4-28)41-23(39)18(36)16(21)34/h2,6,8-39H,3-5H2,1H3/t6-,8+,9-,10-,11-,12-,13+,14+,15+,16-,17-,18-,19-,20-,21-,22-,23?,24-,25-/m1/s1 |
| InChIKey | XUFXOAAUWZOOIT-UGEKTDRHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.1 (alpha-amylase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-amylase (EC 3.2.1.1). EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acarbose (CHEBI:2376) has role EC 3.2.1.1 (α-amylase) inhibitor (CHEBI:50627) |
| acarbose (CHEBI:2376) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| acarbose (CHEBI:2376) has role geroprotector (CHEBI:176497) |
| acarbose (CHEBI:2376) has role hypoglycemic agent (CHEBI:35526) |
| acarbose (CHEBI:2376) is a tetrasaccharide derivative (CHEBI:63567) |
| acarbose (CHEBI:2376) is conjugate base of acarbose(1+) (CHEBI:84363) |
| Incoming Relation(s) |
| acarbose 7IV-phosphate (CHEBI:85517) has functional parent acarbose (CHEBI:2376) |
| acarbose(1+) (CHEBI:84363) is conjugate acid of acarbose (CHEBI:2376) |
| IUPAC Name |
|---|
| 4,6-dideoxy-4-{[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino}-α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucopyranose |
| INNs | Source |
|---|---|
| acarbosa | WHO MedNet |
| acarbose | WHO MedNet |
| acarbose | WHO MedNet |
| acarbosum | WHO MedNet |
| Synonym | Source |
|---|---|
| Precose | ChemIDplus |
| Brand Names | Source |
|---|---|
| Glucobay | DrugBank |
| Precose | DrugBank |
| Citations |
|---|