EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H46O18 |
| Net Charge | 0 |
| Average Mass | 742.724 |
| Monoisotopic Mass | 742.26841 |
| SMILES | [H][C@@]12CO[C@@H](c3cc(OC)c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(OC)c3)[C@]1([H])CO[C@H]2c1cc(OC)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C34H46O18/c1-43-17-5-13(6-18(44-2)31(17)51-33-27(41)25(39)23(37)21(9-35)49-33)29-15-11-48-30(16(15)12-47-29)14-7-19(45-3)32(20(8-14)46-4)52-34-28(42)26(40)24(38)22(10-36)50-34/h5-8,15-16,21-30,33-42H,9-12H2,1-4H3/t15-,16-,21-,22-,23-,24-,25+,26+,27-,28-,29+,30+,33+,34+/m1/s1 |
| InChIKey | FFDULTAFAQRACT-NYYYOYJKSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-syringaresinol O,O'-bis(β-D-glucoside) (CHEBI:2375) has functional parent (−)-syringaresinol (CHEBI:49212) |
| (−)-syringaresinol O,O'-bis(β-D-glucoside) (CHEBI:2375) has role anti-inflammatory agent (CHEBI:67079) |
| (−)-syringaresinol O,O'-bis(β-D-glucoside) (CHEBI:2375) has role antioxidant (CHEBI:22586) |
| (−)-syringaresinol O,O'-bis(β-D-glucoside) (CHEBI:2375) has role plant metabolite (CHEBI:76924) |
| (−)-syringaresinol O,O'-bis(β-D-glucoside) (CHEBI:2375) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (7β,7'β,8β,8'β)-4,4'-bis(β-D-glucopyranosyloxy)-3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignan |
| Synonyms | Source |
|---|---|
| Acanthoside D | KEGG COMPOUND |
| (-)-Syringaresinol di-beta-D-glucoside | KEGG COMPOUND |
| (7β,7'β,8β,8'β)-4,4'-bis(β-D-glucopyranosyloxy)-3,3',5,5'-tetramethoxy-7,9':7',9-diepoxylignan | JCBN |
| Manual Xrefs | Databases |
|---|---|
| C10543 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4839236 | Reaxys |
| CAS:66791-77-3 | KEGG COMPOUND |
| Citations |
|---|