EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | C(CCC1CO1)CC1CO1 |
| InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 |
| InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2:7,8-diepoxyoctane (CHEBI:23705) has parent hydride octane (CHEBI:17590) |
| 1,2:7,8-diepoxyoctane (CHEBI:23705) has role mutagen (CHEBI:25435) |
| 1,2:7,8-diepoxyoctane (CHEBI:23705) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| 2,2'-butane-1,4-diyldioxirane |
| Synonyms | Source |
|---|---|
| 1,2,7,8-Diepoxyoctane | ChemIDplus |
| 1,2-Epoxy-7,8-epoxyoctane | ChemIDplus |
| 1,7-Octadiene diepoxide | ChemIDplus |
| 2,2'-(1,4-Butanediyl)bisoxirane | ChemIDplus |