EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | C1OC1C1CO1 |
| InChI | InChI=1S/C4H6O2/c1-3(5-1)4-2-6-4/h3-4H,1-2H2 |
| InChIKey | ZFIVKAOQEXOYFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diepoxybutane (CHEBI:23704) has role mutagen (CHEBI:25435) |
| diepoxybutane (CHEBI:23704) is a epoxide (CHEBI:32955) |
| Incoming Relation(s) |
| (R*,R*)-diepoxybutane (CHEBI:51049) is a diepoxybutane (CHEBI:23704) |
| meso-diepoxybutane (CHEBI:51046) is a diepoxybutane (CHEBI:23704) |
| IUPAC Name |
|---|
| 2,2'-bioxirane |
| Synonyms | Source |
|---|---|
| 1,2:3,4-diepoxybutane | ChemIDplus |
| bioxirane | NIST Chemistry WebBook |
| DEB | NIST Chemistry WebBook |
| butadiene diepoxide | NIST Chemistry WebBook |
| Butadiendioxyd | ChemIDplus |
| 1,1'-bi[ethylene oxide] | NIST Chemistry WebBook |