EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H40O6 |
| Net Charge | 0 |
| Average Mass | 496.644 |
| Monoisotopic Mass | 496.28249 |
| SMILES | [H][C@]12OC(=O)[C@@H](C)[C@]1([H])CC[C@](C)(O)[C@]1([H])[C@@H]3C=C(C)[C@]21[C@@]1([H])C(C)=C2[C@@]([H])([C@@]31[H])[C@@](C)(O)CC[C@@]1([H])[C@H](C)C(=O)O[C@]21[H] |
| InChI | InChI=1S/C30H40O6/c1-12-11-18-20-21(30(12)24(18)29(6,34)10-8-17-14(3)27(32)36-25(17)30)15(4)19-22(20)28(5,33)9-7-16-13(2)26(31)35-23(16)19/h11,13-14,16-18,20-25,33-34H,7-10H2,1-6H3/t13-,14-,16-,17-,18+,20-,21-,22-,23-,24-,25-,28-,29-,30+/m0/s1 |
| InChIKey | PZHWYURJZAPXAN-ILOFNVQHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia absinthium (ncbitaxon:72332) | - | PubMed (25037681) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| absinthin (CHEBI:2366) has role anti-inflammatory agent (CHEBI:67079) |
| absinthin (CHEBI:2366) has role plant metabolite (CHEBI:76924) |
| absinthin (CHEBI:2366) is a organic heteroheptacyclic compound (CHEBI:52157) |
| absinthin (CHEBI:2366) is a sesquiterpene lactone (CHEBI:37667) |
| absinthin (CHEBI:2366) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (1R,2R,5S,8S,9S,12S,13R,14S,15S,16R,17S,20S,21S,24S)-12,17-dihydroxy-3,8,12,17,21,25-hexamethyl-6,23-dioxaheptacyclo[13.9.2.01,16.02,14.04,13.05,9.020,24]hexacosa-3,25-diene-7,22-dione |
| Synonyms | Source |
|---|---|
| (+)-absinthin | ChEBI |
| Absinthin | KEGG COMPOUND |
| Absynthin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Absinthin | Wikipedia |
| C00000172 | KNApSAcK |
| C09286 | KEGG COMPOUND |
| CN101658656 | Patent |
| HMDB0035742 | HMDB |
| SE530687 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4730201 | Reaxys |
| CAS:1362-42-1 | KEGG COMPOUND |
| CAS:1362-42-1 | ChemIDplus |
| Citations |
|---|