EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C14H18N6O.H2O4S |
| Net Charge | 0 |
| Average Mass | 670.757 |
| Monoisotopic Mass | 670.27580 |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1.Nc1nc(NC2CC2)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1.O=S(=O)(O)O |
| InChI | InChI=1S/2C14H18N6O.H2O4S/c2*15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21;1-5(2,3)4/h2*1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19);(H2,1,2,3,4)/t2*8-,10+;/m11./s1 |
| InChIKey | WMHSRBZIJNQHKT-FFKFEZPRSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abacavir sulfate (CHEBI:2361) has functional parent abacavir (CHEBI:421707) |
| abacavir sulfate (CHEBI:2361) has role anti-HIV agent (CHEBI:64946) |
| abacavir sulfate (CHEBI:2361) has role antipsoriatic (CHEBI:50748) |
| abacavir sulfate (CHEBI:2361) is a azaheterocycle sulfate salt (CHEBI:38017) |
| IUPAC Name |
|---|
| bis({(1S,4R)-4-[2-amino-6-(cyclopropylamino)-9H-purin-9-yl]cyclopent-2-en-1-yl}methanol) sulfate |
| Synonyms | Source |
|---|---|
| 1592U89 SULFATE | ChEMBL |
| Abacavir (as sulfate) | ChEMBL |
| Abacavir hemisulfate | ChEMBL |
| Abacaviri sulfas | ChEMBL |
| Abacavir sulfate | KEGG COMPOUND |
| Abacavir sulfate racemic | ChEMBL |
| Brand Names | Source |
|---|---|
| Abacavir sulfate component of epzicom | ChEMBL |
| Abacavir sulfate component of kivexa | ChEMBL |
| Abacavir sulfate component of triumeq | ChEMBL |
| Abacavir sulfate component of trizivir | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| AU2003242983 | Patent |
| D00891 | KEGG DRUG |
| JP2010189419 | Patent |
| WO2004089952 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:188062-50-2 | KEGG COMPOUND |
| Citations |
|---|