EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N4O2 |
| Net Charge | 0 |
| Average Mass | 288.351 |
| Monoisotopic Mass | 288.15863 |
| SMILES | N=C(N)NCCC[C@H](/N=C/C=C/c1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H20N4O2/c16-15(17)19-11-5-9-13(14(20)21)18-10-4-8-12-6-2-1-3-7-12/h1-4,6-8,10,13H,5,9,11H2,(H,20,21)(H4,16,17,19)/b8-4+,18-10+/t13-/m0/s1 |
| InChIKey | NAJYDXSWMXFMJB-MJLJNSGSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenargimine (CHEBI:235519) has role agrochemical (CHEBI:33286) |
| fenargimine (CHEBI:235519) has role nematicide (CHEBI:25491) |
| fenargimine (CHEBI:235519) is a L-arginine derivative (CHEBI:83965) |
| fenargimine (CHEBI:235519) is a guanidines (CHEBI:24436) |
| fenargimine (CHEBI:235519) is a imine (CHEBI:24783) |
| fenargimine (CHEBI:235519) is a monocarboxylic acid (CHEBI:25384) |
| fenargimine (CHEBI:235519) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (E)-N2-[(2E)-3-phenylprop-2-en-1-ylidene]-L-arginine |
| Synonyms | Source |
|---|---|
| (2S)-5-carbamimidamido-2-{(E)-[(2E)-3-phenylprop-2-en-1-ylidene]amino}pentanoic acid | IUPAC |
| [N2(E)]-N2-[(2E)-3-phenyl-2-propen-1-ylidene]-L-arginine | ChEBI |
| (S)-5-guanidino-2-(((1E,2E)-3-phenylallylidene)amino)pentanoic acid | ChEBI |
| (2S)-5-guanidino-2-{(E)-[(2E)-3-phenylallylidene]amino}valeric acid | ChEBI |
| (2S)-5-guanidino-2-{(E)-[(2E)-3-phenylprop-2-en-1-ylidene]amino}pentanoic acid | ChEBI |
| (2S)-5-(carbamimidoylamino)-2-{(E)-[(2E)-3-phenylprop-2-en-1-ylidene]amino}pentanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:61053306 | Reaxys |
| CAS:3053452-57-3 | ChEBI |