EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21N3O |
| Net Charge | 0 |
| Average Mass | 379.463 |
| Monoisotopic Mass | 379.16846 |
| SMILES | Cc1cc(-c2ccc(CC(=O)Nc3ccc(-c4cccnc4)cc3)cc2)ccn1 |
| InChI | InChI=1S/C25H21N3O/c1-18-15-22(12-14-27-18)20-6-4-19(5-7-20)16-25(29)28-24-10-8-21(9-11-24)23-3-2-13-26-17-23/h2-15,17H,16H2,1H3,(H,28,29) |
| InChIKey | KHZOJCQBHJUJFY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Wnt-C59 (CHEBI:235513) has role anti-inflammatory agent (CHEBI:67079) |
| Wnt-C59 (CHEBI:235513) has role antineoplastic agent (CHEBI:35610) |
| Wnt-C59 (CHEBI:235513) has role Wnt signalling inhibitor (CHEBI:78031) |
| Wnt-C59 (CHEBI:235513) is a benzamides (CHEBI:22702) |
| Wnt-C59 (CHEBI:235513) is a methylpyridines (CHEBI:25340) |
| Wnt-C59 (CHEBI:235513) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-[4-(2-methylpyridin-4-yl)phenyl]-N-[4-(pyridin-3-yl)phenyl]acetamide |
| Synonyms | Source |
|---|---|
| 4-(2-methyl-4-pyridinyl)-N-[4-(3-pyridinyl)phenyl]benzeneacetamide | ChEBI |
| C59 | ChEBI |
| 2-(4-(2-methylpyridin-4-yl)phenyl)-N-(4-(pyridin-3-yl)phenyl)acetamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0259900 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1243243-89-1 | ChEBI |
| Citations |
|---|