EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O3 |
| Net Charge | 0 |
| Average Mass | 302.374 |
| Monoisotopic Mass | 302.16304 |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2C(N)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C17H22N2O3/c1-19-7-6-16-13-9-2-3-11(20)14(13)22-15(16)10(18)4-5-17(16,21)12(19)8-9/h2-3,10,12,15,20-21H,4-8,18H2,1H3/t10?,12-,15+,16+,17-/m1/s1 |
| InChIKey | KMVAXAKRXABEMD-RPCBQCAJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-oxymorphamine (CHEBI:235467) is a morphinane alkaloid (CHEBI:25418) |
| β-oxymorphamine (CHEBI:235467) is a organic heteropentacyclic compound (CHEBI:38164) |
| β-oxymorphamine (CHEBI:235467) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 6-amino-17-methyl-5α-4,5-epoxymorphinan-3,14-diol |
| Registry Numbers | Sources |
|---|---|
| CAS:84800-62-4 | ChEBI |
| Citations |
|---|