EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N6O18P3 |
| Net Charge | -5 |
| Average Mass | 741.369 |
| Monoisotopic Mass | 741.03874 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](N3C=CCC(C(=O)[O-])=C3)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C21H29N6O18P3/c22-17-12-18(24-7-23-17)27(8-25-12)20-16(44-46(33,34)35)14(29)11(43-20)6-41-48(38,39)45-47(36,37)40-5-10-13(28)15(30)19(42-10)26-3-1-2-9(4-26)21(31)32/h1,3-4,7-8,10-11,13-16,19-20,28-30H,2,5-6H2,(H,31,32)(H,36,37)(H,38,39)(H2,22,23,24)(H2,33,34,35)/p-5/t10-,11-,13-,14-,15-,16-,19-,20-/m1/s1 |
| InChIKey | XIOOWIZIIAKBFO-HISDBWNOSA-I |
| Roles Classification |
|---|
| Chemical Role: | electron donor A molecular entity that can transfer an electron to another molecular entity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NAADPH(5−) (CHEBI:235461) is a hydrogen donor (CHEBI:17499) |
| NAADPH(5−) (CHEBI:235461) is a ribonucleoside triphosphate oxoanion (CHEBI:59724) |
| UniProt Name | Source |
|---|---|
| NAADPH | UniProt |
| Citations |
|---|