EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H11NO4 |
| Net Charge | 0 |
| Average Mass | 293.278 |
| Monoisotopic Mass | 293.06881 |
| SMILES | COc1cccc2c1cc1c3c(cc4c(c32)OCO4)C(O)=N1 |
| InChI | InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19) |
| InChIKey | MXOKGWUJNGEKBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aristolactam I (CHEBI:235435) is a alkaloid (CHEBI:22315) |