EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14O6 |
| Net Charge | 0 |
| Average Mass | 266.249 |
| Monoisotopic Mass | 266.07904 |
| SMILES | [H][C@]1(C)OC(=O)c2c(O)c(C(=O)O)c(O)c(C)c2[C@]1([H])C |
| InChI | InChI=1S/C13H14O6/c1-4-6(3)19-13(18)8-7(4)5(2)10(14)9(11(8)15)12(16)17/h4,6,14-15H,1-3H3,(H,16,17)/t4-,6-/m1/s1 |
| InChIKey | VVVMDYGNIVXIIG-INEUFUBQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrocitrinone (CHEBI:235420) is a 2-hydroxyisophthalic acid (CHEBI:19643) |