EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17N3O |
| Net Charge | 0 |
| Average Mass | 267.332 |
| Monoisotopic Mass | 267.13716 |
| SMILES | Nn1cnc2c(c1=O)C1(CCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H17N3O/c17-19-10-18-14-12-6-2-1-5-11(12)9-16(7-3-4-8-16)13(14)15(19)20/h1-2,5-6,10H,3-4,7-9,17H2 |
| InChIKey | VQMVFISLGPSWGO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SMER 10 (CHEBI:235416) has role autophagy inducer (CHEBI:138880) |
| SMER 10 (CHEBI:235416) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 3-aminospiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
| Citations |
|---|