EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CC(C)CCOC(=O)c1ccccc1C(=O)OCCC(C)C |
| InChI | InChI=1S/C18H26O4/c1-13(2)9-11-21-17(19)15-7-5-6-8-16(15)18(20)22-12-10-14(3)4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | JANBFCARANRIKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diisopentyl phthalate (CHEBI:235320) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| bis(3-methylbutyl) benzene-1,2-dicarboxylate |
| Registry Numbers | Sources |
|---|---|
| CAS:605-50-5 | SUBMITTER |
| Citations |
|---|