EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O5 |
| Net Charge | 0 |
| Average Mass | 243.219 |
| Monoisotopic Mass | 243.08552 |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| InChIKey | UHDGCWIWMRVCDJ-CCXZUQQUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytarabine (CHEBI:28680) has functional parent cytosine (CHEBI:16040) |
| cytarabine (CHEBI:28680) has role antimetabolite (CHEBI:35221) |
| cytarabine (CHEBI:28680) has role antineoplastic agent (CHEBI:35610) |
| cytarabine (CHEBI:28680) has role antiviral agent (CHEBI:22587) |
| cytarabine (CHEBI:28680) has role immunosuppressive agent (CHEBI:35705) |
| cytarabine (CHEBI:28680) is a monosaccharide derivative (CHEBI:63367) |
| cytarabine (CHEBI:28680) is a pyrimidine nucleoside (CHEBI:26440) |
| cytarabine (CHEBI:28680) is a β-D-arabinoside (CHEBI:38315) |
| IUPAC Name |
|---|
| 4-amino-1-β-D-arabinofuranosylpyrimidin-2(1H)-one |
| INNs | Source |
|---|---|
| citarabina | ChemIDplus |
| cytarabine | WHO MedNet |
| cytarabine | ChemIDplus |
| cytarabinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-beta-D-Arabinofuranosylcytosine | ChemIDplus |
| 4-Amino-1-beta-D-arabinofuranosyl-2(1H)-pyrimidinone | ChemIDplus |
| arabinocytosine | DrugCentral |
| Arabinoside C | DrugCentral |
| ara-C | ChEBI |
| Cytarabine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 770 | DrugCentral |
| AR3 | PDBeChem |
| C02961 | KEGG COMPOUND |
| Cytarabine | Wikipedia |
| D00168 | KEGG DRUG |
| DB00987 | DrugBank |
| HMDB0015122 | HMDB |
| LSM-5470 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:89175 | Reaxys |
| CAS:147-94-4 | KEGG COMPOUND |
| CAS:147-94-4 | ChemIDplus |
| Citations |
|---|