EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37NO5 |
| Net Charge | 0 |
| Average Mass | 479.617 |
| Monoisotopic Mass | 479.26717 |
| SMILES | [H][C@]12[C@H](Cc3ccccc3)NC(=O)[C@]13OC(=O)/C=C/[C@H](O)CCC[C@@H](C)C/C=C/[C@@]3([H])[C@H](O)C(=C)[C@H]2C |
| InChI | InChI=1S/C29H37NO5/c1-18-9-7-13-22(31)15-16-25(32)35-29-23(14-8-10-18)27(33)20(3)19(2)26(29)24(30-28(29)34)17-21-11-5-4-6-12-21/h4-6,8,11-12,14-16,18-19,22-24,26-27,31,33H,3,7,9-10,13,17H2,1-2H3,(H,30,34)/b14-8+,16-15+/t18-,19-,22-,23+,24+,26+,27-,29-/m1/s1 |
| InChIKey | GBOGMAARMMDZGR-TYHYBEHESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | actin polymerisation inhibitor Any substance that inhibits the polymerisation of the protein actin. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mycotoxin Poisonous substance produced by fungi. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytochalasin B (CHEBI:23527) has role actin polymerisation inhibitor (CHEBI:70728) |
| cytochalasin B (CHEBI:23527) has role metabolite (CHEBI:25212) |
| cytochalasin B (CHEBI:23527) has role mycotoxin (CHEBI:25442) |
| cytochalasin B (CHEBI:23527) has role platelet aggregation inhibitor (CHEBI:50427) |
| cytochalasin B (CHEBI:23527) is a cytochalasin (CHEBI:23528) |
| cytochalasin B (CHEBI:23527) is a lactam (CHEBI:24995) |
| cytochalasin B (CHEBI:23527) is a lactone (CHEBI:25000) |
| cytochalasin B (CHEBI:23527) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3E,5R,9R,11E,12aS,13S,15S,15aS,16S,18aS)-16-benzyl-5,13-dihydroxy-9,15-dimethyl-14-methylidene-6,7,8,9,10,12a,13,14,15,15a,16,17-dodecahydro-2H-oxacyclotetradecino[2,3-d]isoindole-2,18(5H)-dione |
| Synonym | Source |
|---|---|
| Phomin | ChEBI |
| UniProt Name | Source |
|---|---|
| cytochalasin B | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00011322 | KNApSAcK |
| C19954 | KEGG COMPOUND |
| CPD-20745 | MetaCyc |
| Cytochalasin_B | Wikipedia |
| LMPK11000002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1096210 | Reaxys |
| CAS:14930-96-2 | ChemIDplus |
| Citations |
|---|