EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O11P2 |
| Net Charge | 0 |
| Average Mass | 403.177 |
| Monoisotopic Mass | 403.01818 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H15N3O11P2/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(22-8)3-21-25(19,20)23-24(16,17)18/h1-2,4,6-8,13-14H,3H2,(H,19,20)(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | ZWIADYZPOWUWEW-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP (CHEBI:17239) has role Escherichia coli metabolite (CHEBI:76971) |
| CDP (CHEBI:17239) has role mouse metabolite (CHEBI:75771) |
| CDP (CHEBI:17239) is a cytidine 5'-phosphate (CHEBI:23521) |
| CDP (CHEBI:17239) is a pyrimidine ribonucleoside 5'-diphosphate (CHEBI:37039) |
| CDP (CHEBI:17239) is conjugate acid of CDP(3−) (CHEBI:58069) |
| Incoming Relation(s) |
| 2'-deoxy-5-hydroxymethyl-CDP (CHEBI:835) has functional parent CDP (CHEBI:17239) |
| CDP-1L-myo-inositol (CHEBI:62566) has functional parent CDP (CHEBI:17239) |
| CDP-2,3-bis-O-(geranylgeranyl)-sn-glycerol (CHEBI:50726) has functional parent CDP (CHEBI:17239) |
| CDP-choline (CHEBI:16436) has functional parent CDP (CHEBI:17239) |
| CDP-sugar (CHEBI:20873) has functional parent CDP (CHEBI:17239) |
| dCDP (CHEBI:28846) has functional parent CDP (CHEBI:17239) |
| CDP(3−) (CHEBI:58069) is conjugate base of CDP (CHEBI:17239) |
| IUPAC Name |
|---|
| cytidine 5'-(trihydrogen diphosphate) |
| Synonyms | Source |
|---|---|
| 5'-CDP | ChemIDplus |
| CDP | KEGG COMPOUND |
| Cytidine 5'-diphosphate | KEGG COMPOUND |
| CYTIDINE-5'-DIPHOSPHATE | PDBeChem |
| Cytidine 5'-diphosphoric acid | ChemIDplus |
| Cytidine 5'-pyrophosphate | ChemIDplus |