EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26ClN2O3S2.Na |
| Net Charge | 0 |
| Average Mass | 537.082 |
| Monoisotopic Mass | 536.09711 |
| SMILES | [H]/C(=C(/[H])c1ccc2ccc(Cl)cc2n1)c1cccc(C(SCCC(=O)[O-])SCCC(=O)N(C)C)c1.[Na+] |
| InChI | InChI=1S/C26H27ClN2O3S2.Na/c1-29(2)24(30)12-14-33-26(34-15-13-25(31)32)20-5-3-4-18(16-20)6-10-22-11-8-19-7-9-21(27)17-23(19)28-22;/h3-11,16-17,26H,12-15H2,1-2H3,(H,31,32);/q;+1/p-1/b10-6+; |
| InChIKey | XNAYQOBPAXEYLI-AAGWESIMSA-M |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MK-571 (CHEBI:234612) has role inhibitor (CHEBI:35222) |
| MK-571 (CHEBI:234612) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| sodium;3-[[3-[(E)-2-(7-chloroquinolin-2-yl)ethenyl]phenyl]-[3-(dimethylamino)-3-oxopropyl]sulfanylmethyl]sulfanylpropanoate |
| Registry Numbers | Sources |
|---|---|
| CAS:115103-85-0 | SUBMITTER |