EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14BrN3O |
| Net Charge | 0 |
| Average Mass | 356.223 |
| Monoisotopic Mass | 355.03202 |
| SMILES | [H]/C(=C(C#N)\C(O)=N\[C@@]([H])(C)c1ccccc1)c1cccc(Br)n1 |
| InChI | InChI=1S/C17H14BrN3O/c1-12(13-6-3-2-4-7-13)20-17(22)14(11-19)10-15-8-5-9-16(18)21-15/h2-10,12H,1H3,(H,20,22)/b14-10+/t12-/m0/s1 |
| InChIKey | VFUAJMPDXIRPKO-LQELWAHVSA-N |
| Roles Classification |
|---|
| Biological Role: | STAT3 inhibitor An inhibitor of signal transducer and activator of transcription 3 (STAT3) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WP1066 (CHEBI:234609) has role STAT3 inhibitor (CHEBI:87183) |
| WP1066 (CHEBI:234609) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (E)-3-(6-bromopyridin-2-yl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| Synonym | Source |
|---|---|
| WP 1066 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB12679 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:857064-38-1 | SUBMITTER |
| Citations |
|---|