EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H38N2O3S |
| Net Charge | 0 |
| Average Mass | 614.811 |
| Monoisotopic Mass | 614.26031 |
| SMILES | [H][C@@]12C=C[C@H](NC(=O)CCSC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C39H38N2O3S/c1-41-23-22-38-30-18-19-31(37(38)44-36-33(42)20-17-26(35(36)38)25-32(30)41)40-34(43)21-24-45-39(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-20,30-32,37,42H,21-25H2,1H3,(H,40,43)/t30-,31-,32+,37-,38-/m0/s1 |
| InChIKey | VJBNBUDWKBTFDH-BPGMNCLWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MorHap (CHEBI:234595) has functional parent morphine (CHEBI:17303) |
| MorHap (CHEBI:234595) has role hapten (CHEBI:59174) |
| MorHap (CHEBI:234595) is a benzenes (CHEBI:22712) |
| MorHap (CHEBI:234595) is a morphinane alkaloid (CHEBI:25418) |
| MorHap (CHEBI:234595) is a organic heteropentacyclic compound (CHEBI:38164) |
| MorHap (CHEBI:234595) is a organic sulfide (CHEBI:16385) |
| MorHap (CHEBI:234595) is a secondary carboxamide (CHEBI:140325) |
| MorHap (CHEBI:234595) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(3-hydroxy-17-methyl-5α-7,8-didehydro-4,5-epoxymorphinan-6α-yl)-3-[(triphenylmethyl)sulfanyl]propanamide |
| Citations |
|---|