EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2 |
| Net Charge | 0 |
| Average Mass | 230.355 |
| Monoisotopic Mass | 230.17830 |
| SMILES | [H][C@]1(N[C@@H]2C[C@H]2c2ccccc2)CC[C@H](N)CC1 |
| InChI | InChI=1S/C15H22N2/c16-12-6-8-13(9-7-12)17-15-10-14(15)11-4-2-1-3-5-11/h1-5,12-15,17H,6-10,16H2/t12-,13-,14-,15+/m0/s1 |
| InChIKey | ALHBJBCQLJZYON-ZQDZILKHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iadademstat (CHEBI:234592) has role antineoplastic agent (CHEBI:35610) |
| Iadademstat (CHEBI:234592) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Iadademstat | ChEMBL |
| ORY-1001 | SUBMITTER |
| RG-6016 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1431304-21-0 | SUBMITTER |
| Citations |
|---|