EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21ClF3NO4 |
| Net Charge | 0 |
| Average Mass | 431.838 |
| Monoisotopic Mass | 431.11112 |
| SMILES | CCOCCC(O)COc1ccccc1/C(O)=N/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21ClF3NO4/c1-2-28-10-9-14(26)12-29-18-6-4-3-5-15(18)19(27)25-13-7-8-17(21)16(11-13)20(22,23)24/h3-8,11,14,26H,2,9-10,12H2,1H3,(H,25,27) |
| InChIKey | QWKQVWRMGISHJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | histone acetyltransferase activator Any compound that binds to and activates the enzyme histone acetyltransferase (EC 2.3.1.48). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-ethoxy-2-hydroxybutoxy)benzamide (CHEBI:234584) has role histone acetyltransferase activator (CHEBI:90374) |
| N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-ethoxy-2-hydroxybutoxy)benzamide (CHEBI:234584) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| ZINC434638142 | SUBMITTER |
| Citations |
|---|