EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17ClF3NO5 |
| Net Charge | 0 |
| Average Mass | 443.805 |
| Monoisotopic Mass | 443.07473 |
| SMILES | COC(=O)CCC(=O)COc1ccccc1/C(O)=N/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17ClF3NO5/c1-29-18(27)9-7-13(26)11-30-17-5-3-2-4-14(17)19(28)25-12-6-8-16(21)15(10-12)20(22,23)24/h2-6,8,10H,7,9,11H2,1H3,(H,25,28) |
| InChIKey | ULTPJRKSZZEZIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | histone acetyltransferase activator Any compound that binds to and activates the enzyme histone acetyltransferase (EC 2.3.1.48). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenoxy]-4-oxopentanoate (CHEBI:234583) has role histone acetyltransferase activator (CHEBI:90374) |
| methyl 5-[2-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]phenoxy]-4-oxopentanoate (CHEBI:234583) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| ZINC579411635 | SUBMITTER |
| Citations |
|---|