EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28O2 |
| Net Charge | 0 |
| Average Mass | 252.398 |
| Monoisotopic Mass | 252.20893 |
| SMILES | [H]/C(C)=C(\[H])C/C([H])=C(\[H])CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3-,7-6+ |
| InChIKey | ZZGJZGSVLNSDPG-WWVFNRLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plutella xylostella (ncbitaxon:51655) | - | PubMed (40035506) |
| Roles Classification |
|---|
| Biological Role: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9E,12Z)-tetradeca-9,12-dienyl acetate (CHEBI:234573) has role pheromone (CHEBI:26013) |
| (9E,12Z)-tetradeca-9,12-dienyl acetate (CHEBI:234573) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| [(9E,12Z)-tetradeca-9,12-dienyl] acetate |
| Synonyms | Source |
|---|---|
| cis-9-trans-12-tetradecadien-1-ol acetate | SUBMITTER |
| Z9,E12-14:Ac | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:31654-77-0 | SUBMITTER |
| Citations |
|---|