EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16ClO6P |
| Net Charge | 0 |
| Average Mass | 346.703 |
| Monoisotopic Mass | 346.03730 |
| SMILES | CCOP(=O)(OCC)Oc1ccc2c(C)c(Cl)c(=O)oc2c1 |
| InChI | InChI=1S/C14H16ClO6P/c1-4-18-22(17,19-5-2)21-10-6-7-11-9(3)13(15)14(16)20-12(11)8-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | FDYMERLIFOUIRZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coumaphos oxon (CHEBI:234570) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| coumaphos oxon (CHEBI:234570) has role insecticide (CHEBI:24852) |
| coumaphos oxon (CHEBI:234570) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (3-chloro-4-methyl-2-oxochromen-7-yl) diethyl phosphate |
| Synonyms | Source |
|---|---|
| 3-chloro-7-hydroxy-4-methylcoumarin diethyl phosphate | SUBMITTER |
| coroxon | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:321-54-0 | SUBMITTER |
| Citations |
|---|