EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28FN3O2 |
| Net Charge | 0 |
| Average Mass | 421.516 |
| Monoisotopic Mass | 421.21656 |
| SMILES | Oc1ccc(-c2ccc(N3CCN(CCNCc4ccc(F)cc4)CC3)cc2)cc1O |
| InChI | InChI=1S/C25H28FN3O2/c26-22-6-1-19(2-7-22)18-27-11-12-28-13-15-29(16-14-28)23-8-3-20(4-9-23)21-5-10-24(30)25(31)17-21/h1-10,17,27,30-31H,11-16,18H2 |
| InChIKey | VVXJYQXCWYXDMO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[4-[4-[2-[(4-fluorophenyl)methylamino]ethyl]piperazin-1-yl]phenyl]benzene-1,2-diol (CHEBI:234561) has role inhibitor (CHEBI:35222) |
| 4-[4-[4-[2-[(4-fluorophenyl)methylamino]ethyl]piperazin-1-yl]phenyl]benzene-1,2-diol (CHEBI:234561) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|