EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H33N3O3S2 |
| Net Charge | 0 |
| Average Mass | 487.691 |
| Monoisotopic Mass | 487.19633 |
| SMILES | [H]/C(C(=N)O)=C(\OC)[C@]([H])(C)[C@@]([H])(OC)/C([H])=C(\[H])c1csc(-c2csc([C@@]([H])(C)/C([H])=C([H])/C([H])=C(\[H])C(C)C)n2)n1 |
| InChI | InChI=1S/C25H33N3O3S2/c1-16(2)9-7-8-10-17(3)24-28-20(15-33-24)25-27-19(14-32-25)11-12-21(30-5)18(4)22(31-6)13-23(26)29/h7-18,21H,1-6H3,(H2,26,29)/b9-7+,10-8+,12-11+,22-13+/t17-,18+,21-/m0/s1 |
| InChIKey | XKTFQMCPGMTBMD-FYHMSGCOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Role: | EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thenoyltrifluoroacetone (CHEBI:234560) has role chelator (CHEBI:38161) |
| thenoyltrifluoroacetone (CHEBI:234560) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| thenoyltrifluoroacetone (CHEBI:234560) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| Manual Xrefs | Databases |
|---|---|
| DB04795 | DrugBank |
| HMDB0245319 | HMDB |
| https://en.wikipedia.org/wiki/Thenoyltrifluoroacetone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:326-91-0 | SUBMITTER |
| Citations |
|---|