EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N5O2 |
| Net Charge | 0 |
| Average Mass | 469.589 |
| Monoisotopic Mass | 469.24778 |
| SMILES | [H][C@]1(/N=c2\nc3ccnc3c(=O)n2CC=C)CN(C)C[C@@]([H])(c2ccc(OCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H31N5O2/c1-3-15-33-27(34)26-25(13-14-29-26)31-28(33)30-23-16-22(17-32(2)18-23)21-9-11-24(12-10-21)35-19-20-7-5-4-6-8-20/h3-14,22-23,29H,1,15-19H2,2H3,(H,30,31)/t22-,23+/m0/s1 |
| InChIKey | NBDJDKAXIGWAIM-XZOQPEGZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.1.1.* (methyltransferases) inhibitor An EC 2.1.* (C1-transferase) inhibitor that interferes with the action of any methyltransferase (EC 2.1.1.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SETDB1-TTD-IN-1 (CHEBI:234559) has role EC 2.1.1.* (methyltransferases) inhibitor (CHEBI:76871) |
| SETDB1-TTD-IN-1 (CHEBI:234559) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 2-[[(3R,5R)-1-methyl-5-(4-phenylmethoxyphenyl)piperidin-3-yl]amino]-3-prop-2-enyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| Synonym | Source |
|---|---|
| (R,R)-59 | SUBMITTER |
| Citations |
|---|