EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23BrN6O5S |
| Net Charge | 0 |
| Average Mass | 551.423 |
| Monoisotopic Mass | 550.06340 |
| SMILES | [H][C@@]1(Nc2ncncc2C(=O)c2ccn(Cc3cccc(Br)c3)n2)C[C@]([H])(COS(N)(=O)=O)[C@@]([H])(O)C1 |
| InChI | InChI=1S/C21H23BrN6O5S/c22-15-3-1-2-13(6-15)10-28-5-4-18(27-28)20(30)17-9-24-12-25-21(17)26-16-7-14(19(29)8-16)11-33-34(23,31)32/h1-6,9,12,14,16,19,29H,7-8,10-11H2,(H2,23,31,32)(H,24,25,26)/t14-,16-,19+/m1/s1 |
| InChIKey | PZCKLTWSXFDLLP-OGWOLHLISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.3.2.* (aminoacyltransferase) inhibitor An EC 2.3.* (acyltransferase) inhibitor that interferes with the action of any aminoacyltransferase (EC 2.3.2.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ML-792 (CHEBI:234558) has role EC 2.3.2.* (aminoacyltransferase) inhibitor (CHEBI:76877) |
| ML-792 (CHEBI:234558) is a aminopyrimidine (CHEBI:38338) |
| ML-792 (CHEBI:234558) is a bromobenzenes (CHEBI:37149) |
| ML-792 (CHEBI:234558) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| [(1R,2S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| Citations |
|---|