EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31O2.Na |
| Net Charge | 0 |
| Average Mass | 278.412 |
| Monoisotopic Mass | 278.22217 |
| SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1 |
| InChIKey | GGXKEBACDBNFAF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | emulsifier The chemical role played by a substance that stabilizes an emulsion by increasing its kinetic stability. surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium palmitate (CHEBI:234557) has role emulsifier (CHEBI:63046) |
| sodium palmitate (CHEBI:234557) has role surfactant (CHEBI:35195) |
| sodium palmitate (CHEBI:234557) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| sodium;hexadecanoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0303302 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:408-35-5 | SUBMITTER |
| Citations |
|---|