EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O4 |
| Net Charge | 0 |
| Average Mass | 352.390 |
| Monoisotopic Mass | 352.14231 |
| SMILES | COc1cc(-c2cc(-c3cccc(O)c3)cnc2N)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O4/c1-24-17-9-13(10-18(25-2)19(17)26-3)16-8-14(11-22-20(16)21)12-5-4-6-15(23)7-12/h4-11,23H,1-3H3,(H2,21,22) |
| InChIKey | CJLMANFTWLNAKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bone morphogenetic protein receptor antagonist An antagonist at the bone morphogenetic protein receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| K02288 (CHEBI:234540) has role bone morphogenetic protein receptor antagonist (CHEBI:78623) |
| K02288 (CHEBI:234540) is a aminopyridine (CHEBI:38207) |
| K02288 (CHEBI:234540) is a methoxybenzenes (CHEBI:51683) |
| K02288 (CHEBI:234540) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| 3-[6-amino-5-(3,4,5-trimethoxyphenyl)pyridin-3-yl]phenol | SUBMITTER |
| Citations |
|---|