EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O4 |
| Net Charge | 0 |
| Average Mass | 398.503 |
| Monoisotopic Mass | 398.22056 |
| SMILES | [H][C@@]12C[C@H](/C(=C\OC)C(=O)OC)[C@@H](CC)CN1CCc1c2nc2cccc(OC)c12 |
| InChI | InChI=1S/C23H30N2O4/c1-5-14-12-25-10-9-15-21-18(7-6-8-20(21)28-3)24-22(15)19(25)11-16(14)17(13-27-2)23(26)29-4/h6-8,13-14,16,19,24H,5,9-12H2,1-4H3/b17-13+/t14-,16-,19-/m0/s1 |
| InChIKey | LELBFTMXCIIKKX-CYSPOEIOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mitragyna inermis (ncbitaxon:170023) | Leaf (PO:0025034) | PubMed (4397465) | |
| Mitragyna speciosa (ncbitaxon:170351) | - | PubMed (34867362) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| speciogynine (CHEBI:234539) has role anticonvulsant (CHEBI:35623) |
| speciogynine (CHEBI:234539) has role plant metabolite (CHEBI:76924) |
| speciogynine (CHEBI:234539) is a enol ether (CHEBI:47985) |
| speciogynine (CHEBI:234539) is a methyl ester (CHEBI:25248) |
| speciogynine (CHEBI:234539) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| speciogynine (CHEBI:234539) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| methyl (16E)-9-methoxy-16-(methoxymethylidene)corynan-17-oate |
| Synonyms | Source |
|---|---|
| (+)-speciogynine | ChEBI |
| (αE,2S,3R,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydro-8-methoxy-α-(methoxymethylene)-indolo[2,3-a]quinolizine-2-acetic acid methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00025211 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:4697-67-0 | KNApSAcK |
| Citations |
|---|