EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H32ClF10N7O5S2 |
| Net Charge | 0 |
| Average Mass | 968.296 |
| Monoisotopic Mass | 967.14352 |
| SMILES | [H][C@@]12C[C@]1([H])c1c(C(F)(F)F)nn(CC(=O)N[C@@H](Cc3cc(F)cc(F)c3)c3nc(C#CC(C)(C)S(C)(=O)=O)ccc3-c3ccc(Cl)c4c(NS(C)(=O)=O)nn(CC(F)(F)F)c34)c1C2(F)F |
| InChI | InChI=1S/C39H32ClF10N7O5S2/c1-36(2,63(3,59)60)10-9-21-5-6-22(23-7-8-26(40)30-32(23)57(17-37(43,44)45)54-35(30)55-64(4,61)62)31(51-21)27(13-18-11-19(41)14-20(42)12-18)52-28(58)16-56-34-29(33(53-56)39(48,49)50)24-15-25(24)38(34,46)47/h5-8,11-12,14,24-25,27H,13,15-17H2,1-4H3,(H,52,58)(H,54,55)/t24-,25+,27-/m0/s1 |
| InChIKey | BRYXUCLEHAUSDY-WEWMWRJBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lenacapavir (CHEBI:234519) has role anti-HIV agent (CHEBI:64946) |
| Lenacapavir (CHEBI:234519) has role antiviral agent (CHEBI:22587) |
| Lenacapavir (CHEBI:234519) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[(1S)-1-{3-[4-chloro-3-methanesulfonamido-1-(2,2,2-trifluoroethyl)-1H-indazol-7-yl]-6-(3-methanesulfonyl-3-methylbut-1-yn-1-yl)pyridin-2-yl}-2-(3,5-difluorophenyl)ethyl]-2-[(2S,4R)-5,5-difluoro-9-(trifluoromethyl)-7,8-diazatricyclo[4.3.0.0^{2,4}]nona-1(6),8-dien-7-yl]acetamide |
| Synonyms | Source |
|---|---|
| GS-6207 | ChEMBL |
| GS6207 | ChEMBL |
| GS-714207 | ChEMBL |
| GS-CA1 | ChEMBL |
| GS-CA-2 | ChEMBL |
| GS-CA2 | ChEMBL |
| Brand Names | Source |
|---|---|
| Sunlenca | SUBMITTER |
| Yeztugo | SUBMITTER |
| Citations |
|---|