EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4ClNO |
| Net Charge | 0 |
| Average Mass | 93.513 |
| Monoisotopic Mass | 92.99814 |
| SMILES | NC(=O)CCl |
| InChI | InChI=1S/C2H4ClNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | VXIVSQZSERGHQP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. fungicide A substance used to destroy fungal pests. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | fungicide A substance used to destroy fungal pests. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloroacetamide (CHEBI:234507) has role antimicrobial agent (CHEBI:33281) |
| 2-chloroacetamide (CHEBI:234507) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| 2-chloroacetamide (CHEBI:234507) has role fungicide (CHEBI:24127) |
| 2-chloroacetamide (CHEBI:234507) has role herbicide (CHEBI:24527) |
| 2-chloroacetamide (CHEBI:234507) is a N-acylammonia (CHEBI:83628) |
| 2-chloroacetamide (CHEBI:234507) is a monocarboxylic acid amide (CHEBI:29347) |
| 2-chloroacetamide (CHEBI:234507) is a organochlorine compound (CHEBI:36683) |
| 2-chloroacetamide (CHEBI:234507) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| 2-chloroacetamide |
| Synonyms | Source |
|---|---|
| chloracetamide | ChEBI |
| chloroacetamide | ChEBI |
| α-chloroacetamide | ChEBI |
| alpha-chloroacetamide | ChEBI |
| KM 101 | ChEBI |
| KM 101 (fungicide) | ChEBI |
| Brand Name | Source |
|---|---|
| Microcide Mergal AF | ChEBI |
| UniProt Name | Source |
|---|---|
| chloroacetamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0250106 | HMDB |
| Chloroacetamide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:878191 | Reaxys |
| CAS:79-07-2 | NIST Chemistry WebBook |
| Citations |
|---|