EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4ClNO |
| Net Charge | 0 |
| Average Mass | 93.513 |
| Monoisotopic Mass | 92.99814 |
| SMILES | NC(=O)CCl |
| InChI | InChI=1S/C2H4ClNO/c3-1-2(4)5/h1H2,(H2,4,5) |
| InChIKey | VXIVSQZSERGHQP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungicide A substance used to destroy fungal pests. antimicrobial cosmetic preservative An antimicrobial agent that is added to cosmetic formulations to maintain the microbiological safety of the products by inhibiting the growth of fungi or bacteria. |
| Applications: | herbicide A substance used to destroy plant pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloroacetamide (CHEBI:234507) has role antimicrobial agent (CHEBI:33281) |
| 2-chloroacetamide (CHEBI:234507) has role antimicrobial cosmetic preservative (CHEBI:172949) |
| 2-chloroacetamide (CHEBI:234507) has role fungicide (CHEBI:24127) |
| 2-chloroacetamide (CHEBI:234507) has role herbicide (CHEBI:24527) |
| 2-chloroacetamide (CHEBI:234507) is a N-acylammonia (CHEBI:83628) |
| 2-chloroacetamide (CHEBI:234507) is a monocarboxylic acid amide (CHEBI:29347) |
| 2-chloroacetamide (CHEBI:234507) is a organochlorine compound (CHEBI:36683) |
| 2-chloroacetamide (CHEBI:234507) is a primary carboxamide (CHEBI:140324) |
| IUPAC Name |
|---|
| 2-chloroacetamide |
| Synonyms | Source |
|---|---|
| alpha-chloroacetamide | ChEBI |
| chloracetamide | ChEBI |
| chloroacetamide | ChEBI |
| KM 101 | ChEBI |
| KM 101 (fungicide) | ChEBI |
| α-chloroacetamide | ChEBI |
| Brand Name | Source |
|---|---|
| Microcide Mergal AF | ChEBI |
| UniProt Name | Source |
|---|---|
| chloroacetamide | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Chloroacetamide | Wikipedia |
| HMDB0250106 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:878191 | Reaxys |
| CAS:79-07-2 | NIST Chemistry WebBook |
| Citations |
|---|