EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO7 |
| Net Charge | 0 |
| Average Mass | 389.404 |
| Monoisotopic Mass | 389.14745 |
| SMILES | [H][C@]12CC[C@]([H])([C@@H](C(=O)OC)[C@@H](OC(=O)c3ccccc3)C1)N2C(=O)CCC(=O)O |
| InChI | InChI=1S/C20H23NO7/c1-27-20(26)18-14-8-7-13(21(14)16(22)9-10-17(23)24)11-15(18)28-19(25)12-5-3-2-4-6-12/h2-6,13-15,18H,7-11H2,1H3,(H,23,24)/t13-,14+,15-,18+/m0/s1 |
| InChIKey | JXRRURSUEBIBGP-JTOWHCCKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-succinyl norcocaine (CHEBI:234506) has functional parent norcocaine (CHEBI:178585) |
| N-succinyl norcocaine (CHEBI:234506) has functional parent succinic acid (CHEBI:15741) |
| N-succinyl norcocaine (CHEBI:234506) has role hapten (CHEBI:59174) |
| N-succinyl norcocaine (CHEBI:234506) is a benzoate ester (CHEBI:36054) |
| N-succinyl norcocaine (CHEBI:234506) is a methyl ester (CHEBI:25248) |
| N-succinyl norcocaine (CHEBI:234506) is a monocarboxylic acid (CHEBI:25384) |
| N-succinyl norcocaine (CHEBI:234506) is a tertiary carboxamide (CHEBI:140326) |
| N-succinyl norcocaine (CHEBI:234506) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| 4-[(1R,2R,3S,5S)-3-(benzoyloxy)-2-(methoxycarbonyl)-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutanoic acid |
| Synonyms | Source |
|---|---|
| 4-[(1R,2R,3S,5S)-3-benzoyloxy-2-methoxycarbonyl-8-azabicyclo[3.2.1]octan-8-yl]-4-oxobutanoic acid | ChEBI |
| SNC | ChEBI |
| succinyl norcocaine | ChEBI |
| succinylnorcocaine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:183793-33-1 | ChEBI |
| Citations |
|---|