EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H42N2O5S |
| Net Charge | 0 |
| Average Mass | 674.863 |
| Monoisotopic Mass | 674.28144 |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(NC(=O)CCSC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]3Cc4ccc(O)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C41H42N2O5S/c1-27(44)47-33-20-22-40(34-26-28-18-19-32(45)37-36(28)39(40,38(33)48-37)23-24-43(34)2)42-35(46)21-25-49-41(29-12-6-3-7-13-29,30-14-8-4-9-15-30)31-16-10-5-11-17-31/h3-19,33-34,38,45H,20-26H2,1-2H3,(H,42,46)/t33-,34+,38-,39-,40+/m0/s1 |
| InChIKey | PYCVPSNQUOGXRF-KKZHGYSASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-AmidoHerHap (CHEBI:234496) has role hapten (CHEBI:59174) |
| 14-AmidoHerHap (CHEBI:234496) is a acetate ester (CHEBI:47622) |
| 14-AmidoHerHap (CHEBI:234496) is a benzenes (CHEBI:22712) |
| 14-AmidoHerHap (CHEBI:234496) is a morphinane alkaloid (CHEBI:25418) |
| 14-AmidoHerHap (CHEBI:234496) is a organic heteropentacyclic compound (CHEBI:38164) |
| 14-AmidoHerHap (CHEBI:234496) is a organic sulfide (CHEBI:16385) |
| 14-AmidoHerHap (CHEBI:234496) is a secondary carboxamide (CHEBI:140325) |
| 14-AmidoHerHap (CHEBI:234496) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-hydroxy-17-methyl-14-{3-[(triphenylmethyl)sulfanyl]propanamido}-5α-4,5-epoxymorphinan-6α-yl acetate |
| Synonym | Source |
|---|---|
| (4aS,7S,7aR,12bR)-9-hydroxy-3-methyl-4a-(3-(tritylthio)propanamido)-2,3,4,4a,5,6,7,7aoctahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl acetate | ChEBI |
| Citations |
|---|