EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H40N2O4S |
| Net Charge | 0 |
| Average Mass | 632.826 |
| Monoisotopic Mass | 632.27088 |
| SMILES | CN1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](O)CC[C@@]3(NC(=O)CCSC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1C5 |
| InChI | InChI=1S/C39H40N2O4S/c1-41-23-22-37-34-26-17-18-30(42)35(34)45-36(37)31(43)19-21-38(37,32(41)25-26)40-33(44)20-24-46-39(27-11-5-2-6-12-27,28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-18,31-32,36,42-43H,19-25H2,1H3,(H,40,44)/t31-,32+,36-,37-,38+/m0/s1 |
| InChIKey | QNRRMXXRPDDZCR-IOMPEVEMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 14-AmidoMorHap (CHEBI:234495) has role hapten (CHEBI:59174) |
| 14-AmidoMorHap (CHEBI:234495) is a benzenes (CHEBI:22712) |
| 14-AmidoMorHap (CHEBI:234495) is a diol (CHEBI:23824) |
| 14-AmidoMorHap (CHEBI:234495) is a morphinane alkaloid (CHEBI:25418) |
| 14-AmidoMorHap (CHEBI:234495) is a organic heteropentacyclic compound (CHEBI:38164) |
| 14-AmidoMorHap (CHEBI:234495) is a organic sulfide (CHEBI:16385) |
| 14-AmidoMorHap (CHEBI:234495) is a secondary carboxamide (CHEBI:140325) |
| 14-AmidoMorHap (CHEBI:234495) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(3,6α-dihydroxy-17-methyl-5α-4,5-epoxymorphinan-14-yl)-3-[(triphenylmethyl)sulfanyl]propanamide |
| Synonym | Source |
|---|---|
| N-((4aS,7S,7aR,12bR)-7,9-dihydroxy-3-methyl-1,2,3,4,5,6,7,7a-octahydro-4aH-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl)-3-(tritylthio)propenamide | ChEBI |
| Citations |
|---|