EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC(C)(C)CC1=C(C)[C@@]1([H])CC[C@@]1(C)C2 |
| InChI | InChI=1S/C15H24/c1-10-12-9-14(2,3)7-11(12)8-15(4)6-5-13(10)15/h11,13H,5-9H2,1-4H3/t11-,13+,15-/m0/s1 |
| InChIKey | HULFPDOHEQOINC-LNSITVRQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondrostereum purpureum (ncbitaxon:58369) | - | DOI (10.1139/v81-364) | Species also known as Stereum purpureum. |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sterpurene (CHEBI:234481) has role fungal metabolite (CHEBI:76946) |
| sterpurene (CHEBI:234481) is a carbotricyclic compound (CHEBI:38032) |
| sterpurene (CHEBI:234481) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (2aS,3aS,7aS)-2a,5,5,7-tetramethyl-2,2a,3,3a,4,5,6,7a-octahydro-1H-cyclobuta[f]indene |
| Synonyms | Source |
|---|---|
| 1-sterpurene | KNApSAcK |
| 2-sterpurene | ChEBI |
| (+)-2-sterpurene | LIPID MAPS |
| UniProt Name | Source |
|---|---|
| sterpurene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMPR0103600001 | LIPID MAPS |
| C00021476 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:79579-56-9 | ChEBI |
| Citations |
|---|