EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15N3O2 |
| Net Charge | 0 |
| Average Mass | 245.282 |
| Monoisotopic Mass | 245.11643 |
| SMILES | O=C(O)c1ccc(CNCCc2cncn2)cc1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(18)11-3-1-10(2-4-11)7-14-6-5-12-8-15-9-16-12/h1-4,8-9,14H,5-7H2,(H,15,16)(H,17,18) |
| InChIKey | TUAURFMXUMTJNM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid (CHEBI:234472) has role hapten (CHEBI:59174) |
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid (CHEBI:234472) is a benzoic acids (CHEBI:22723) |
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid (CHEBI:234472) is a imidazoles (CHEBI:24780) |
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid (CHEBI:234472) is a monocarboxylic acid (CHEBI:25384) |
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid (CHEBI:234472) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 4-({[2-(1H-imidazol-4-yl)ethyl]amino}methyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 4-(((2-(1H-imidazol-4-yl)ethyl)amino)methyl)benzoic acid | ChEBI |
| 4-[[2-(1H-imidazol-5-yl)ethylamino]methyl]benzoic acid | ChEBI |
| HA-245 | ChEBI |
| hapten HA-245 | ChEBI |
| Hapten-HA-245 | ChEBI |
| Citations |
|---|