EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:234469 - cannabinolic acid
| Formula | C22H26O4 |
| Net Charge | 0 |
| Average Mass | 354.446 |
| Monoisotopic Mass | 354.18311 |
| SMILES | CCCCCc1cc2c(c(O)c1C(=O)O)-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C22H26O4/c1-5-6-7-8-14-12-17-19(20(23)18(14)21(24)25)15-11-13(2)9-10-16(15)22(3,4)26-17/h9-12,23H,5-8H2,1-4H3,(H,24,25) |
| InChIKey | KXKOBIRSQLNUPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cannabinolic acid (CHEBI:234469) has role anti-inflammatory agent (CHEBI:67079) |
| cannabinolic acid (CHEBI:234469) has role antibacterial agent (CHEBI:33282) |
| cannabinolic acid (CHEBI:234469) has role neuroprotective agent (CHEBI:63726) |
| cannabinolic acid (CHEBI:234469) has role plant metabolite (CHEBI:76924) |
| cannabinolic acid (CHEBI:234469) is a benzochromene (CHEBI:38920) |
| cannabinolic acid (CHEBI:234469) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| cannabinolic acid (CHEBI:234469) is a phytocannabinoid (CHEBI:67196) |
| cannabinolic acid (CHEBI:234469) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 1-hydroxy-6,6,9-trimethyl-3-pentyl-6H-benzo[c]chromene-2-carboxylic acid |
| Synonyms | Source |
|---|---|
| CBNA | ChEBI |
| 1-hydroxy-6,6,9-trimethyl-3-pentyl-6H-dibenzo[b,d]pyran-2-carboxylic acid | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LMPK13120007 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2808-39-1 | ChEBI |
| Citations |
|---|