EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34ClN3S2 |
| Net Charge | 0 |
| Average Mass | 428.111 |
| Monoisotopic Mass | 427.18827 |
| SMILES | CN1[C@H]2CC[C@@H]1[C@@H](CN(CCS)CCNCCS)[C@@H](c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C21H34ClN3S2/c1-24-18-6-7-21(24)20(15-25(11-13-27)10-8-23-9-12-26)19(14-18)16-2-4-17(22)5-3-16/h2-5,18-21,23,26-27H,6-15H2,1H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | HZLFSOZSLFKJKA-JSXRDJHFSA-N |
| Roles Classification |
|---|
| Chemical Roles: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TRODAT-1 (CHEBI:234467) has role chelator (CHEBI:38161) |
| TRODAT-1 (CHEBI:234467) is a azabicycloalkane (CHEBI:38295) |
| TRODAT-1 (CHEBI:234467) is a dithiol (CHEBI:23853) |
| TRODAT-1 (CHEBI:234467) is a monochlorobenzenes (CHEBI:83403) |
| TRODAT-1 (CHEBI:234467) is a secondary amino compound (CHEBI:50995) |
| TRODAT-1 (CHEBI:234467) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| [99mTc]TRODAT-1 (CHEBI:234508) has functional parent TRODAT-1 (CHEBI:234467) |
| IUPAC Name |
|---|
| 2-({[(1R,2R,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl}{2-[(2-sulfanylethyl)amino]ethyl}amino)ethanethiol |
| INNs | Source |
|---|---|
| tropantiolum | WHO MedNet |
| tropantiol | WHO MedNet |
| tropantiol | WHO MedNet |
| tropantiol | WHO MedNet |
| Synonyms | Source |
|---|---|
| 2-({[(1R,2R,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl}{2-[(2-sulfanylethyl)amino]ethyl}amino)ethane-1-thiol | IUPAC |
| NC100697 | ChEBI |
| NC-100697 | ChEBI |
| NC 100697 | ChEBI |
| TRODAT | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:189950-11-6 | PubChem Compound |
| Citations |
|---|