EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO |
| Net Charge | 0 |
| Average Mass | 231.339 |
| Monoisotopic Mass | 231.16231 |
| SMILES | CCCC(C(=O)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C15H21NO/c1-2-8-14(16-11-6-7-12-16)15(17)13-9-4-3-5-10-13/h3-5,9-10,14H,2,6-8,11-12H2,1H3 |
| InChIKey | YDIIDRWHPFMLGR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-pyrrolidinopentiophenone (CHEBI:234463) has role dopamine uptake inhibitor (CHEBI:51039) |
| α-pyrrolidinopentiophenone (CHEBI:234463) has role psychotropic drug (CHEBI:35471) |
| α-pyrrolidinopentiophenone (CHEBI:234463) is a N-alkylpyrrolidine (CHEBI:46775) |
| α-pyrrolidinopentiophenone (CHEBI:234463) is a aromatic ketone (CHEBI:76224) |
| α-pyrrolidinopentiophenone (CHEBI:234463) is a benzenes (CHEBI:22712) |
| IUPAC Name |
|---|
| 1-phenyl-2-(pyrrolidin-1-yl)pentan-1-one |
| Synonyms | Source |
|---|---|
| 1-phenyl-2-(1-pyrrolidinyl)-1-pentanone | ChEBI |
| 2-(pyrrolidin-1-yl)phenylpentan-1-one | ChEBI |
| alpha-PVP | ChEBI |
| alpha-pyrrolidinovalerophenone | ChEBI |
| desmethylpyrovalerone | ChEBI |
| flakka | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C22754 | KEGG COMPOUND |
| %CE%91-Pyrrolidinopentiophenone | Wikipedia |
| HMDB0244638 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:14530-33-7 | ChEBI |
| Citations |
|---|