EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O2 |
| Net Charge | 0 |
| Average Mass | 276.380 |
| Monoisotopic Mass | 276.18378 |
| SMILES | [H][C@@]1(c2ccc(CCCCCC(=O)O)nc2)CCCN1C |
| InChI | InChI=1S/C16H24N2O2/c1-18-11-5-7-15(18)13-9-10-14(17-12-13)6-3-2-4-8-16(19)20/h9-10,12,15H,2-8,11H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | JDAPBANSEVVDRE-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-{5-[(2S)-1-methylpyrrolidin-2-yl]pyridin-2-yl}hexanoic acid (CHEBI:234462) has role hapten (CHEBI:59174) |
| 6-{5-[(2S)-1-methylpyrrolidin-2-yl]pyridin-2-yl}hexanoic acid (CHEBI:234462) is a N-alkylpyrrolidine (CHEBI:46775) |
| 6-{5-[(2S)-1-methylpyrrolidin-2-yl]pyridin-2-yl}hexanoic acid (CHEBI:234462) is a monocarboxylic acid (CHEBI:25384) |
| 6-{5-[(2S)-1-methylpyrrolidin-2-yl]pyridin-2-yl}hexanoic acid (CHEBI:234462) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 6-{5-[(2S)-1-methylpyrrolidin-2-yl]pyridin-2-yl}hexanoic acid |
| Synonym | Source |
|---|---|
| nicotine-6-hexanoic acid | ChEBI |
| Citations |
|---|