EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N8O |
| Net Charge | 0 |
| Average Mass | 404.478 |
| Monoisotopic Mass | 404.20731 |
| SMILES | CN1C(=O)c2ccccc2N(C)c2nc(Nc3cnn(C4CCNCC4)c3)ncc21 |
| InChI | InChI=1S/C21H24N8O/c1-27-17-6-4-3-5-16(17)20(30)28(2)18-12-23-21(26-19(18)27)25-14-11-24-29(13-14)15-7-9-22-10-8-15/h3-6,11-13,15,22H,7-10H2,1-2H3,(H,23,25,26) |
| InChIKey | LKOFXMLMYKWELM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XMD-17-51 (CHEBI:234455) has role antineoplastic agent (CHEBI:35610) |
| XMD-17-51 (CHEBI:234455) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| XMD-17-51 (CHEBI:234455) is a aromatic amine (CHEBI:33860) |
| XMD-17-51 (CHEBI:234455) is a piperidines (CHEBI:26151) |
| XMD-17-51 (CHEBI:234455) is a pyrazoles (CHEBI:26410) |
| XMD-17-51 (CHEBI:234455) is a pyrimidobenzodiazepine (CHEBI:60326) |
| XMD-17-51 (CHEBI:234455) is a secondary amino compound (CHEBI:50995) |
| XMD-17-51 (CHEBI:234455) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5,11-dimethyl-2-{[1-(piperidin-4-yl)-1H-pyrazol-4-yl]amino}-5,11-dihydro-6H-pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| Synonyms | Source |
|---|---|
| XMD 17 51 | ChEBI |
| XMD1751 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1628614-50-5 | ChEBI |
| Citations |
|---|