EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N4O5 |
| Net Charge | 0 |
| Average Mass | 468.554 |
| Monoisotopic Mass | 468.23727 |
| SMILES | CCN(CC)CCn1c(Cc2ccc(OCCCCC(=O)O)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C25H32N4O5/c1-3-27(4-2)14-15-28-23-13-10-20(29(32)33)18-22(23)26-24(28)17-19-8-11-21(12-9-19)34-16-6-5-7-25(30)31/h8-13,18H,3-7,14-17H2,1-2H3,(H,30,31) |
| InChIKey | JDASCQRIRLXNQP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) has role hapten (CHEBI:59174) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a C-nitro compound (CHEBI:35716) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a aromatic ether (CHEBI:35618) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a benzenes (CHEBI:22712) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a benzimidazoles (CHEBI:22715) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a monocarboxylic acid (CHEBI:25384) |
| 5-(4-((1-(2-(diethylamino)ethyl)-5-nitro-1H-benzo[d]imidazol-2-yl)methyl)phenoxy)pentanoic acid (CHEBI:234447) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 5-[4-({1-[2-(diethylamino)ethyl]-5-nitro-1H-benzimidazol-2-yl}methyl)phenoxy]pentanoic acid |
| Citations |
|---|