EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14ClNO2 |
| Net Charge | 0 |
| Average Mass | 239.702 |
| Monoisotopic Mass | 239.07131 |
| SMILES | N[C@@]1(c2ccccc2Cl)CCC[C@@H](O)C1=O |
| InChI | InChI=1S/C12H14ClNO2/c13-9-5-2-1-4-8(9)12(14)7-3-6-10(15)11(12)16/h1-2,4-5,10,15H,3,6-7,14H2/t10-,12-/m1/s1 |
| InChIKey | CFBVGSWSOJBYGC-ZYHUDNBSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,6R)-6-hydroxynorketamine (CHEBI:234441) is a 6-hydroxynorketamine (CHEBI:234436) |
| IUPAC Name |
|---|
| (2R,6R)-2-amino-2-(2-chlorophenyl)-6-hydroxycyclohexanone |
| Synonyms | Source |
|---|---|
| (2R,6R)-2-amino-2-(2-chlorophenyl)-6-hydroxycyclohexan-1-one | IUPAC |
| (2R,6R)-HNK | ChEBI |
| (2R,6R)-hydroxynorketamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:120199-64-6 | ChEBI |
| Citations |
|---|