EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N5O |
| Net Charge | 0 |
| Average Mass | 313.405 |
| Monoisotopic Mass | 313.19026 |
| SMILES | CCNCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C17H23N5O/c1-4-19-9-13-21-14-15(22(13)10-17(2,3)23)11-7-5-6-8-12(11)20-16(14)18/h5-8,19,23H,4,9-10H2,1-3H3,(H2,18,20) |
| InChIKey | FHJATBIERQTCTN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Toll-like receptor 7 agonist An agonist that selectively binds to and activates the Toll-like receptor 7 (TLR7) protein. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gardiquimod (CHEBI:234430) has role antineoplastic agent (CHEBI:35610) |
| gardiquimod (CHEBI:234430) has role apoptosis inducer (CHEBI:68495) |
| gardiquimod (CHEBI:234430) has role hepatoprotective agent (CHEBI:62868) |
| gardiquimod (CHEBI:234430) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| gardiquimod (CHEBI:234430) has role immunomodulator (CHEBI:50846) |
| gardiquimod (CHEBI:234430) has role Toll-like receptor 7 agonist (CHEBI:234474) |
| gardiquimod (CHEBI:234430) is a aromatic amine (CHEBI:33860) |
| gardiquimod (CHEBI:234430) is a imidazoquinoline (CHEBI:38776) |
| gardiquimod (CHEBI:234430) is a secondary amino compound (CHEBI:50995) |
| gardiquimod (CHEBI:234430) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1-{4-amino-2-[(ethylamino)methyl]-1H-imidazo[4,5-c]quinolin-1-yl}-2-methylpropan-2-ol |
| Synonyms | Source |
|---|---|
| 1-(4-amino-2-ethylaminomethylimidazo[4,5-c]quinolin-1-yl)-2-methylpropan-2-ol | SUBMITTER |
| 4-amino-2-[(ethylamino)methyl]-α,α-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0252643 | HMDB |
| Gardiquimod | Wikipedia |
| 9K3 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:1020412-43-4 | SUBMITTER |
| Citations |
|---|