EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N5O |
| Net Charge | 0 |
| Average Mass | 313.405 |
| Monoisotopic Mass | 313.19026 |
| SMILES | CCNCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)O |
| InChI | InChI=1S/C17H23N5O/c1-4-19-9-13-21-14-15(22(13)10-17(2,3)23)11-7-5-6-8-12(11)20-16(14)18/h5-8,19,23H,4,9-10H2,1-3H3,(H2,18,20) |
| InChIKey | FHJATBIERQTCTN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Toll-like receptor 7 agonist An agonist that selectively binds to and activates the Toll-like receptor 7 (TLR7) protein. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hepatoprotective agent Any compound that is able to prevent damage to the liver. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gardiquimod (CHEBI:234430) has role antineoplastic agent (CHEBI:35610) |
| gardiquimod (CHEBI:234430) has role apoptosis inducer (CHEBI:68495) |
| gardiquimod (CHEBI:234430) has role hepatoprotective agent (CHEBI:62868) |
| gardiquimod (CHEBI:234430) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| gardiquimod (CHEBI:234430) has role immunomodulator (CHEBI:50846) |
| gardiquimod (CHEBI:234430) has role Toll-like receptor 7 agonist (CHEBI:234474) |
| gardiquimod (CHEBI:234430) is a aromatic amine (CHEBI:33860) |
| gardiquimod (CHEBI:234430) is a imidazoquinoline (CHEBI:38776) |
| gardiquimod (CHEBI:234430) is a secondary amino compound (CHEBI:50995) |
| gardiquimod (CHEBI:234430) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 1-{4-amino-2-[(ethylamino)methyl]-1H-imidazo[4,5-c]quinolin-1-yl}-2-methylpropan-2-ol |
| Synonyms | Source |
|---|---|
| 1-(4-amino-2-ethylaminomethylimidazo[4,5-c]quinolin-1-yl)-2-methylpropan-2-ol | SUBMITTER |
| 4-amino-2-[(ethylamino)methyl]-α,α-dimethyl-1H-imidazo[4,5-c]quinoline-1-ethanol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9K3 | PDBeChem |
| Gardiquimod | Wikipedia |
| HMDB0252643 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1020412-43-4 | SUBMITTER |
| Citations |
|---|