EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H44O4P.CH3O3S |
| Net Charge | 0 |
| Average Mass | 678.828 |
| Monoisotopic Mass | 678.27801 |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)=C(C)C1=O.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C37H44O4P.CH4O3S/c1-29-33(35(39)37(41-3)36(40-2)34(29)38)27-19-8-6-4-5-7-9-20-28-42(30-21-13-10-14-22-30,31-23-15-11-16-24-31)32-25-17-12-18-26-32;1-5(2,3)4/h10-18,21-26H,4-9,19-20,27-28H2,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | GVZFUVXPTPGOQT-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiparkinson drug A drug used in the treatment of Parkinson's disease. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitoquinone mesylate (CHEBI:234429) has role anti-inflammatory agent (CHEBI:67079) |
| mitoquinone mesylate (CHEBI:234429) has role antioxidant (CHEBI:22586) |
| mitoquinone mesylate (CHEBI:234429) has role antiparkinson drug (CHEBI:48407) |
| mitoquinone mesylate (CHEBI:234429) has role antiviral agent (CHEBI:22587) |
| mitoquinone mesylate (CHEBI:234429) has role cardiovascular drug (CHEBI:35554) |
| mitoquinone mesylate (CHEBI:234429) has role geroprotector (CHEBI:176497) |
| mitoquinone mesylate (CHEBI:234429) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)decyl-triphenylphosphanium;methanesulfonate |
| Synonyms | Source |
|---|---|
| mitoQ | SUBMITTER |
| Mitoquinone mesilate | ChEMBL |
| Mitoquinone mesylate | ChEMBL |
| Mitoquinone methanesulfonate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Mitoquinone_mesylate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:845959-50-4 | SUBMITTER |
| Citations |
|---|